Common Name: Lindechunine A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C19H13NO6/c1-23-16-9-5-6-20-14-11(9)13(18-19(16)26-7-25-18)12-8(15(14)22)3-4-10(21)17(12)24-2/h3-6,21H,7H2,1-2H3
InChIKey: InChIKey=ZLFKJSKABHQLAQ-UHFFFAOYSA-N
Formula: C19H13N1O6
Molecular Weight: 351.310385
Exact Mass: 351.074287
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Zhang, C.F., Nakamura, N., Tewtrakul, S., Hattori, M., Sun, Q.S., Wang, Z.T., Fujiwara, T. Chem Pharm Bull (2002) 50, 1195-200
Species:
Notes: Family : Alkaloids, Type : Aporphines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 149.6 |
| 2 (C) | 137.8 |
| 3 (C) | 135.1 |
| 3a (C) | 122.4 |
| 4 (CH) | 117.8 |
| 5 (CH) | 143.6 |
| 6a (C) | 129.9 |
| 7 (C) | 180.2 |
| 7a (C) | 156.9 |
| 8 (CH) | 117.8 |
| 9 (CH) | 116.7 |
| 10 (C) | 144.1 |
| 11 (C) | 144.3 |
| 11a (C) | 126.4 |
| 11b (C) | 124.8 |
| 11c (C) | 99.5 |
| 1' (CH2) | 102.4 |
| 1'' (CH3) | 60.2 |
| 1''' (CH3) | 60 |