Common Name: 15-O-[6 '-(p-Hydroxyphenylacetyl)]-b-D-glucopyrano-sylurospermal A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C29H34O12/c1-15-24-20(32)9-17(12-30)3-2-4-18(10-21(24)40-28(15)37)13-39-29-27(36)26(35)25(34)22(41-29)14-38-23(33)11-16-5-7-19(31)8-6-16/h3,5-8,10,12,20-22,24-27,29,31-32,34-36H,1-2,4,9,11,13-14H2/b17-3+,18-10-/t20-,21+,22+,24+,25+,26-,27+,29+/m0/s1
InChIKey: InChIKey=NGDUYKZDYOOZLX-IPTIBXCDSA-N
Formula: C29H34O12
Molecular Weight: 574.574186
Exact Mass: 574.205027
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Helal, A.M., Nakamura, N., El-Askary, H., Hattori, M. Phytochemistry (2000) 53, 473-7
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 160.9 |
| 2 (CH2) | 27.7 |
| 3 (CH2) | 33.5 |
| 4 (C) | 138.6 |
| 5 (CH) | 128.2 |
| 6 (CH) | 76 |
| 7 (CH) | 51 |
| 8 (CH) | 69.5 |
| 9 (CH2) | 32.3 |
| 10 (C) | 143.8 |
| 11 (C) | 136.8 |
| 12 (C) | 170.9 |
| 13 (CH2) | 124.4 |
| 14 (CH) | 200.1 |
| 15 (CH2) | 68.1 |
| 1' (CH) | 102.3 |
| 2' (CH) | 73 |
| 3' (CH) | 76.5 |
| 4' (CH) | 69.6 |
| 5' (CH) | 73.7 |
| 6' (CH2) | 63.3 |
| 6'a (C) | 172.2 |
| 6'b (CH2) | 40 |
| 6'c (C) | 124.4 |
| 6'd (CH) | 115 |
| 6'e (CH) | 129.9 |
| 6'f (C) | 155.6 |
| 6'g (CH) | 129.9 |
| 6'h (CH) | 115 |