Common Name: 14-O-Methylacetal-15-O-[6 '-(p-hydroxyphenyl-acetyl)]-b-D-glucopyranosylurospermal A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H36O12/c1-15-24-20(40-28(15)36)10-17(4-3-5-18-12-21(24)41-29(18)37-2)13-39-30-27(35)26(34)25(33)22(42-30)14-38-23(32)11-16-6-8-19(31)9-7-16/h5-10,20-22,24-27,29-31,33-35H,1,3-4,11-14H2,2H3/b17-10-,18-5+/t20-,21+,22-,24+,25-,26+,27-,29?,30-/m1/s1
InChIKey: InChIKey=ZWPBLILWVHAYBJ-URBCNZHNSA-N
Formula: C30H36O12
Molecular Weight: 588.600803
Exact Mass: 588.220677
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Helal, A.M., Nakamura, N., El-Askary, H., Hattori, M. Phytochemistry (2000) 53, 473-7
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 122.9 |
| 2 (CH2) | 27.3 |
| 3 (CH2) | 35.2 |
| 4 (C) | 139.2 |
| 5 (CH) | 128.1 |
| 6 (CH) | 75.8 |
| 7 (CH) | 52.5 |
| 8 (CH) | 78.3 |
| 9 (CH2) | 33.1 |
| 10 (C) | 140.8 |
| 11 (C) | 138.7 |
| 12 (C) | 170.5 |
| 13 (CH2) | 119.7 |
| 14 (CH) | 104.7 |
| 15 (CH2) | 68.4 |
| 1' (CH) | 102.6 |
| 2' (CH) | 73.1 |
| 3' (CH) | 76.2 |
| 4' (CH) | 69.6 |
| 5' (CH) | 73.8 |
| 6' (CH2) | 63.4 |
| 14a (CH3) | 56 |
| 6'a (C) | 172.3 |
| 6'b (CH2) | 40.1 |
| 6'c (C) | 124.5 |
| 6'd (CH) | 115.2 |
| 6'e (CH) | 130 |
| 6'f (C) | 155.7 |
| 6'g (CH) | 130 |
| 6'h (CH) | 115.2 |