Common Name: 3',5'-O-Dimethylmyricetin-3-O-b-d-2'',3''-diacetyl-gucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H28O15/c1-10(29)38-24-21(34)18(9-28)41-27(26(24)39-11(2)30)42-25-22(35)19-14(32)7-13(31)8-15(19)40-23(25)12-5-16(36-3)20(33)17(6-12)37-4/h5-8,18,21,24,26-28,31-34H,9H2,1-4H3/t18-,21-,24+,26-,27+/m1/s1
InChIKey: InChIKey=ABOCRUNJMFWRRX-FGZZQOONSA-N
Formula: C27H28O15
Molecular Weight: 592.503284
Exact Mass: 592.14282
NMR Solvent: CDDl3 + DMSO-d6
MHz:
Calibration:
NMR references: 13C - Manguro, L.O., Ugi, I., Hermann, R., Lemmen, P Phytochemistry (2003) 63, 497-502
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.01 |
| 3 (C) | 134.6 |
| 4 (C) | 178.63 |
| 5 (C) | 160.8 |
| 6 (CH) | 99.8 |
| 7 (C) | 163.7 |
| 8 (CH) | 93.6 |
| 9 (C) | 156.8 |
| 10 (C) | 103.95 |
| 1' (C) | 120 |
| 2' (CH) | 107.6 |
| 3' (C) | 148 |
| 4' (C) | 136.3 |
| 5' (C) | 148 |
| 6' (CH) | 107.6 |
| 1'' (CH) | 102.1 |
| 2'' (CH) | 76.3 |
| 3'' (CH) | 79.65 |
| 4'' (CH) | 68.6 |
| 5'' (CH) | 74.9 |
| 6'' (CH2) | 62.3 |
| 3'a (CH3) | 56.8 |
| 5'a (CH3) | 56.8 |
| 2''a (C) | 170.4 |
| 2''b (CH3) | 20.3 |
| 3''a (C) | 171.3 |
| 3''b (CH3) | 21.45 |