Common Name: 4,5α-Epoxy-7α,5,6,8β(H)-germacr-1(10),11(13)-dien-8α-(3'-oxo-2',5'-dihydrofuran-3'-carboxylyl)-12,6-olide
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H22O7/c1-10-5-4-6-20(3)17(27-20)16-15(11(2)18(22)26-16)13(7-10)25-19(23)12-8-14(21)24-9-12/h5,8,13,15-17H,2,4,6-7,9H2,1,3H3/b10-5+/t13-,15+,16-,17-,20+/m0/s1
InChIKey: InChIKey=KNLRJYTZLFUWPY-MQXFPPTBSA-N
Formula: C20H22O7
Molecular Weight: 374.385249
Exact Mass: 374.136553
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Suleimenov, E.M., Raldugin, V.A., Shakirov, M.M., Adekenov, S.M. Chem Nat Compd (2005) 41, 144-5
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 128.16 |
| 2 (CH2) | 24.25 |
| 3 (CH2) | 35.72 |
| 4 (C) | 60.87 |
| 5 (CH) | 66.31 |
| 6 (CH) | 79.89 |
| 7 (CH) | 49.39 |
| 8 (CH) | 74.23 |
| 9 (CH2) | 47.02 |
| 10 (C) | 128.64 |
| 11 (C) | 133.49 |
| 12 (C) | 171.06 |
| 13 (CH2) | 125.5 |
| 14 (CH3) | 18.25 |
| 15 (CH3) | 17.14 |
| 8a (C) | 153.62 |
| 8b (C) | 160.18 |
| 8c (CH) | 126.75 |
| 8d (C) | 168.26 |
| 8e (CH2) | 70.26 |