Common Name: (1(10)E,4Z)-8b(Angeloxyoxy)-9a,13-diethoxy-6a,15-dihydroxy-14.-oxogermacra-1(10),4-dien-12-oic acid 12,6-lactone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H34O8/c1-5-15(4)23(27)32-22-20-18(14-29-6-2)24(28)31-19(20)11-16(12-25)9-8-10-17(13-26)21(22)30-7-3/h5,10-11,13,18-22,25H,6-9,12,14H2,1-4H3/b15-5-,16-11-,17-10-/t18?,19-,20+,21-,22+/m1/s1
InChIKey: InChIKey=HNVRKAGRXQGKIS-OIBHBSGMSA-N
Formula: C24H34O8
Molecular Weight: 450.522887
Exact Mass: 450.225368
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Xiang, Y., Fan, C.Q., Yue, J.M. Helv Chim Acta (2005) 88, 160-70
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 154.8 |
| 2 (CH2) | 27.4 |
| 3 (CH2) | 32.5 |
| 4 (C) | 138.6 |
| 5 (CH) | 129.9 |
| 6 (CH) | 73.6 |
| 7 (CH) | 47 |
| 8 (CH) | 70.6 |
| 9 (CH) | 76.2 |
| 10 (C) | 141.5 |
| 11 (CH) | 44 |
| 12 (C) | 175.7 |
| 13 (CH2) | 64 |
| 14 (CH) | 193.4 |
| 15 (CH2) | 60.6 |
| 8a (C) | 167.1 |
| 8b (C) | 127.3 |
| 8c (CH) | 139.2 |
| 8d (CH3) | 15.8 |
| 8ba (CH3) | 20.7 |
| 9a (CH2) | 64.4 |
| 9b (CH3) | 15.1 |
| 13a (CH2) | 66.9 |
| 13b (CH3) | 14.9 |