Common Name: 3b,6b,8a-Triacetoxy-4b,5a-epoxy-1-oxogermacr-10(14)-ene
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H30O8/c1-10(2)18-16(26-12(4)22)8-11(3)15(25)9-17(27-13(5)23)21(7)20(29-21)19(18)28-14(6)24/h10,16-20H,3,8-9H2,1-2,4-7H3/t16-,17-,18+,19+,20+,21-/m0/s1
InChIKey: InChIKey=WDKOXDYNTGJFLL-NJCPFYPZSA-N
Formula: C21H30O8
Molecular Weight: 410.458916
Exact Mass: 410.194068
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - i, Y., Wu, Y.Q., Du, X., Shi, Y.P. Planta Med (2003) 69, 782-4
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 199.4 |
| 2 (CH2) | 38.4 |
| 3 (CH) | 69.2 |
| 4 (C) | 57.3 |
| 5 (CH) | 59.6 |
| 6 (CH) | 72.2 |
| 7 (CH) | 47.5 |
| 8 (CH) | 68.4 |
| 9 (CH2) | 38.4 |
| 10 (C) | 147.5 |
| 11 (CH) | 26 |
| 12 (CH3) | 22.8 |
| 13 (CH3) | 20.9 |
| 14 (CH2) | 129.3 |
| 15 (CH3) | 16.3 |
| 3a (C) | 169.8 |
| 3b (CH3) | 20.9 |
| 6a (C) | 169.8 |
| 6b (CH3) | 20.6 |
| 8a (C) | 169.4 |
| 8b (CH3) | 20.5 |