Common Name: Dicliripariside C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C29H34O15/c1-11-19(31)21(33)23(35)28(41-11)40-10-18-20(32)22(34)24(36)29(44-18)43-17-8-14-15(30)9-16(12-4-6-13(38-2)7-5-12)42-26(14)25(37)27(17)39-3/h4-9,11,18-24,28-29,31-37H,10H2,1-3H3/t11-,18+,19-,20+,21+,22-,23+,24+,28+,29+/m0/s1
InChIKey: InChIKey=MBRCWLXDYZVRRR-PZBAPHHGSA-N
Formula: C29H34O15
Molecular Weight: 622.572401
Exact Mass: 622.18977
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Luo Y., Feng C., Tian Y., Zhang G. Phytochemistry (2002) 61, 449-54
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.7 |
| 3 (CH) | 104.3 |
| 4 (C) | 183.1 |
| 5 (CH) | 95.1 |
| 6 (C) | 157.7 |
| 7 (C) | 134 |
| 8 (C) | 153.1 |
| 9 (C) | 154 |
| 10 (C) | 107.1 |
| 1' (C) | 122.9 |
| 2' (CH) | 128.8 |
| 3' (CH) | 115.1 |
| 4' (C) | 163 |
| 5' (CH) | 115.1 |
| 6' (CH) | 128.8 |
| 1'' (CH) | 102.5 |
| 2'' (CH) | 74.6 |
| 3'' (CH) | 71.2 |
| 4'' (CH) | 78.4 |
| 5'' (CH) | 77.6 |
| 6'' (CH2) | 67.6 |
| 1''' (CH) | 102.3 |
| 2''' (CH) | 72 |
| 3''' (CH) | 69.8 |
| 4''' (CH) | 74 |
| 5''' (CH) | 72.8 |
| 6''' (CH3) | 18.5 |
| 7a (CH3) | 60.8 |
| 4'a (CH3) | 55.4 |