Common Name: 3,4,5,6-Tetradehydrogeissoschizine-17-O-b-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H30N2O8/c1-3-14-11-29-9-8-16-15-6-4-5-7-19(15)28-22(16)20(29)10-17(14)18(26(34)35-2)13-36-27-25(33)24(32)23(31)21(12-30)37-27/h3-9,13,17,21,23-25,27,30-33H,10-12H2,1-2H3/b14-3-,18-13+/t17-,21+,23+,24-,25+,27+/m0/s1
InChIKey: InChIKey=RQOSKKZXFRIGDC-FWWAYKISSA-N
Formula: C27H30N2O8
Molecular Weight: 510.536817
Exact Mass: 510.200216
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Wachsmuth O., Matusch R. Phytochemistry (2002) 61, 705-9
Species:
Notes: Family : Alkaloids, Type : Ajmalicines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 135.3 |
| 3 (C) | 141.9 |
| 5 (CH) | 133 |
| 6 (CH) | 116.8 |
| 7 (C) | 132.7 |
| 8 (C) | 121.6 |
| 9 (CH) | 124.1 |
| 10 (CH) | 123.1 |
| 11 (CH) | 132.8 |
| 12 (CH) | 113.8 |
| 13 (C) | 145.4 |
| 14 (CH2) | 30.2 |
| 15 (CH) | 31.6 |
| 16 (C) | 113.9 |
| 17 (CH) | 157.8 |
| 18 (CH3) | 14.1 |
| 19 (CH) | 127.5 |
| 20 (C) | 133.7 |
| 21 (CH2) | 62.4 |
| 22 (C) | 168.7 |
| 1' (CH) | 105.1 |
| 2' (CH) | 74.6 |
| 3' (CH) | 77.9 |
| 4' (CH) | 71.1 |
| 5' (CH) | 78.9 |
| 6' (CH2) | 63.1 |
| 22a (CH3) | 52.1 |