Common Name: 6-(8'-Umbellyferyl)-apigenin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H14O8/c25-13-5-1-11(2-6-13)17-9-15(27)20-18(31-17)10-16(28)21(23(20)30)22-14(26)7-3-12-4-8-19(29)32-24(12)22/h1-10,25-26,28,30H
InChIKey: InChIKey=VWTICXYJGDWYDN-UHFFFAOYSA-N
Formula: C24H14O8
Molecular Weight: 430.364072
Exact Mass: 430.068867
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Franke K., Porzel A., Schmidt J. Phytochemistry (2002) 61, 873-78
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 166 |
| 3 (CH) | 103.8 |
| 4 (C) | 183.8 |
| 5 (C) | 161 |
| 6 (C) | 104.6 |
| 7 (C) | 164.4 |
| 8 (CH) | 94.8 |
| 9 (C) | 159 |
| 10 (C) | 105.2 |
| 1' (C) | 123.2 |
| 2' (CH) | 129.3 |
| 3' (CH) | 116.9 |
| 4' (C) | 162.6 |
| 5' (CH) | 116.9 |
| 6' (CH) | 129.3 |
| 2'' (C) | 164 |
| 3'' (CH) | 111.8 |
| 4'' (CH) | 146.4 |
| 5'' (CH) | 129.7 |
| 6'' (CH) | 114.2 |
| 7'' (C) | 161.3 |
| 8'' (C) | 109.4 |
| 9'' (C) | 155.2 |
| 10'' (C) | 113.3 |