Common Name: 5,7,2',4',6'-Pentamethoxyflavone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H20O7/c1-22-11-7-15(25-4)20(16(8-11)26-5)18-10-13(21)19-14(24-3)6-12(23-2)9-17(19)27-18/h6-10H,1-5H3
InChIKey: InChIKey=BZDNMWJCXMJWNR-UHFFFAOYSA-N
Formula: C20H20O7
Molecular Weight: 372.369368
Exact Mass: 372.120903
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Rao Y.K., Harikishore P., Rao C.V., Gunasekar D., Blond A., Bodo B. Phytochemistry (2002) 61, 927-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.8 |
| 3 (CH) | 116.4 |
| 4 (C) | 177.8 |
| 5 (C) | 160.8 |
| 6 (CH) | 95.8 |
| 7 (C) | 163.6 |
| 8 (CH) | 92.8 |
| 9 (C) | 160.8 |
| 10 (C) | 109.3 |
| 1' (C) | 104.3 |
| 2' (C) | 159.5 |
| 3' (CH) | 90.6 |
| 4' (C) | 163.1 |
| 5' (CH) | 90.6 |
| 6' (C) | 159.5 |
| 5a (CH3) | 56.3 |
| 7a (CH3) | 55.6 |
| 2'a (CH3) | 55.9 |
| 4'a (CH3) | 55.4 |
| 6'a (CH3) | 55.9 |