Spektraris NMR
8alpha-Hydroxy-2-nonyl-5,6,7,8-tetrahydrochromone
Common Name: 8alpha-Hydroxy-2-nonyl-5,6,7,8-tetrahydrochromone
Synonyms: 8alpha-Hydroxy-2-nonyl-5,6,7,8-tetrahydrochromone
CAS Registry Number:
InChI: InChI=1S/C18H28O3/c1-2-3-4-5-6-7-8-10-14-13-17(20)15-11-9-12-16(19)18(15)21-14/h13,16,19H,2-12H2,1H3/t16-/m0/s1
InChIKey: InChIKey=UCVKCMREOJPPIO-INIZCTEOSA-N
Formula: C18H28O3
Molecular Weight: 292.413802
Exact Mass: 292.203845
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Gonzalez M.J., Pinto M.M., Kijjoa A., Kengthong S., Mondanondra I.O., Silva A.M., Eaton G., Herz W. Phytochemistry (2002) 61, 995-8
Species:
Notes: Family : Chromans, Type : Chromones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
Carbon NMR Peaks
| Position | PPM |
|---|---|
| 2 (C) | 169.38 |
| 3 (CH) | 112.71 |
| 4 (C) | 180.81 |
| 5 (CH2) | 27.57 |
| 6 (CH2) | 18.09 |
| 7 (CH2) | 29.45 |
| 8 (CH) | 63.83 |
| 9 (C) | 165.06 |
| 10 (C) | 123.09 |
| 1' (CH2) | 33.51 |
| 2' (CH2) | 26.75 |
| 3' (CH2) | 29.34 |
| 4' (CH2) | 29.18 |
| 5' (CH2) | 29.17 |
| 6' (CH2) | 28.83 |
| 7' (CH2) | 31.78 |
| 8' (CH2) | 22.6 |
| 9' (CH3) | 14.06 |
