Common Name: Ancistrogriffine C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H27NO4/c1-12-8-17-16(6-7-18(26)22(17)19(9-12)28-4)23-20(29-5)11-15-10-13(2)25-14(3)21(15)24(23)27/h6-9,11,13-14,25-27H,10H2,1-5H3/t13-,14-/m0/s1
InChIKey: InChIKey=XVUNMUYOQXRZLI-KBPBESRZSA-N
Formula: C24H27N1O4
Molecular Weight: 393.476425
Exact Mass: 393.194008
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Bringmann G., Wohlfarth M., Rischer H., Schlauer J., Brun R. Phytochemistry (2002) 61, 195-204
Species:
Notes: Family : Alkaloids, Type : Isoquinolines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 47.5 |
| 3 (CH) | 43.5 |
| 4 (CH2) | 33 |
| 4a (C) | 133.3 |
| 5 (CH) | 96.5 |
| 6 (C) | 156.6 |
| 7 (C) | 117.3 |
| 8 (C) | 154 |
| 8a (C) | 114 |
| 1' (CH) | 118.4 |
| 2' (C) | 137.6 |
| 3' (CH) | 107.4 |
| 4' (C) | 156.3 |
| 5' (C) | 155.5 |
| 6' (CH) | 109.5 |
| 7' (CH) | 130.7 |
| 8' (C) | 120.5 |
| 9' (C) | 136 |
| 10' (C) | 113.5 |
| 1a (CH3) | 19.5 |
| 3a (CH3) | 19.8 |
| 6a (CH3) | 55.3 |
| 2'a (CH3) | 22.2 |
| 4'a (CH3) | 56.3 |