Common Name: Mammea E/BB
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H30O7/c1-7-13(5)21(27)20-23(29)15(10-9-12(3)4)22(28)19-16(11-18(26)31-24(19)20)17(8-2)30-14(6)25/h9,11,13,17,28-29H,7-8,10H2,1-6H3
InChIKey: InChIKey=CIJFRPODNXMJFU-UHFFFAOYSA-N
Formula: C24H30O7
Molecular Weight: 430.491719
Exact Mass: 430.199153
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Yang, H., Protiva, P., Gil, R.R., Jiang, B., Baggett, S., Basile, M.J., Reynertson, K.A., Weinstein, I.B., Kennelly, E.J. Planta Med (2005) 71, 852-60
Species:
Notes: Family : Chromans, Type : Coumarins, Group : 4-Propylcoumarins; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.4 |
| 3 (CH) | 106.5 |
| 4 (C) | 158.1 |
| 5 (C) | 157.2 |
| 6 (C) | 110.1 |
| 7 (C) | 165.8 |
| 8 (C) | 104.3 |
| 9 (C) | 156.1 |
| 10 (C) | 100.4 |
| 1' (CH) | 73.7 |
| 2' (CH2) | 28.8 |
| 3' (CH3) | 10.1 |
| 6a (CH2) | 21.7 |
| 6b (CH) | 120 |
| 6c (C) | 138.7 |
| 6d (CH3) | 25.9 |
| 6e (CH3) | 18.9 |
| 8a (C) | 210.8 |
| 8b (CH) | 47 |
| 8c (CH2) | 27.1 |
| 8d (CH3) | 11.7 |
| 8e (CH3) | 16.7 |
| 1'a (C) | 170.4 |
| 1'b (CH3) | 21 |