Common Name: Kuwanon C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O6/c1-13(2)5-8-17-20(28)12-21(29)22-23(30)18(9-6-14(3)4)24(31-25(17)22)16-10-7-15(26)11-19(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3
InChIKey: InChIKey=UWQYBLOHTQWSQD-UHFFFAOYSA-N
Formula: C25H26O6
Molecular Weight: 422.471287
Exact Mass: 422.172939
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Nomura, T., Fukai, T., Narita, T., Terada, S., Uzawa, J., Iitaka, Y., Takasugi, M., Ishikawa, S., Nagao, S., Masamune, T. Tetrahedron Lett (1981) 22, 2195-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.5 |
| 3 (C) | 120.9 |
| 4 (C) | 183.3 |
| 5 (C) | 151.2 |
| 6 (CH) | 98.9 |
| 7 (C) | 162.9 |
| 8 (C) | 106.9 |
| 9 (C) | 162.9 |
| 10 (C) | 105.1 |
| 1' (C) | 113.2 |
| 2' (C) | 161 |
| 3' (CH) | 104.4 |
| 4' (C) | 162.4 |
| 5' (CH) | 108 |
| 6' (CH) | 132.3 |
| 3a (CH2) | 23.5 |
| 3b (CH) | 121.7 |
| 3c (C) | 131.2 |
| 3d (CH3) | 25.4 |
| 3ac (CH3) | 17.3 |
| 8a (CH2) | 21.1 |
| 8b (CH) | 122.1 |
| 8c (C) | 130.7 |
| 8d (CH3) | 17.3 |
| 8ac (CH3) | 25.4 |