Common Name: Kuwanon T
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O6/c1-13(2)5-7-16-19(27)10-9-17(23(16)29)25-18(8-6-14(3)4)24(30)22-20(28)11-15(26)12-21(22)31-25/h5-6,9-12,26-29H,7-8H2,1-4H3
InChIKey: InChIKey=KATQHJZHAFCFAQ-UHFFFAOYSA-N
Formula: C25H26O6
Molecular Weight: 422.471287
Exact Mass: 422.172939
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Fukai, T., Hano, Y., Hirakura, K., Nomura, T., Uzawa, J. Chem Pharm Bull (1985) 33, 4288-95
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 161.6 |
| 3 (C) | 120.2 |
| 4 (C) | 181.8 |
| 5 (C) | 161.5 |
| 6 (CH) | 98.3 |
| 7 (C) | 164 |
| 8 (CH) | 93.4 |
| 9 (C) | 157.9 |
| 10 (C) | 103.7 |
| 1' (C) | 111.8 |
| 2' (C) | 153.3 |
| 3' (C) | 115.8 |
| 4' (C) | 157.8 |
| 5' (CH) | 106.9 |
| 6' (CH) | 127.5 |
| 3a (CH2) | 23.6 |
| 3b (CH) | 121.4 |
| 3c (C) | 130 |
| 3d (CH3) | 25.4 |
| 3ac (CH3) | 17.2 |
| 3'a (CH2) | 22.2 |
| 3'b (CH) | 123 |
| 3'c (C) | 131.1 |
| 3'd (CH3) | 25.5 |
| 3'ac (CH3) | 17.7 |