Common Name: Conyzatin
Synonyms: Conyzatin
CAS Registry Number:
InChI: InChI=1S/C20H20O9/c1-24-12-6-9(7-13(25-2)18(12)27-4)16-20(28-5)15(23)14-10(21)8-11(22)17(26-3)19(14)29-16/h6-8,21-22H,1-5H3
InChIKey: InChIKey=WFUOMXZWZFSZEM-UHFFFAOYSA-N
Formula: C20H20O9
Molecular Weight: 404.368177
Exact Mass: 404.110732
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Roitman, J.N., James, L.F. Phytochemistry (1985) 24, 835-48
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 155.9 |
| 3 (C) | 138.5 |
| 4 (C) | 178.1 |
| 5 (C) | 154.3 |
| 6 (CH) | 98.9 |
| 7 (C) | 157.3 |
| 8 (C) | 127.5 |
| 9 (C) | 148.6 |
| 10 (C) | 104.1 |
| 1' (C) | 125.2 |
| 2' (CH) | 105.6 |
| 3' (C) | 152.7 |
| 4' (C) | 139.9 |
| 5' (C) | 152.7 |
| 6' (CH) | 105.6 |
| 3a (CH3) | 60.2 |
| 8a (CH3) | 60.8 |
| 3'a (CH3) | 59.9 |
| 4'a (CH3) | 55.9 |
| 5'a (CH3) | 59.9 |