Common Name: 6-Hydroxy-2',4',5',7-tetramethoxyisoflavone
Synonyms: 6-Hydroxy-2',4',5',7-tetramethoxyisoflavone
CAS Registry Number:
InChI: InChI=1S/C19H18O7/c1-22-14-7-18(25-4)17(24-3)6-10(14)12-9-26-15-8-16(23-2)13(20)5-11(15)19(12)21/h5-9,20H,1-4H3
InChIKey: InChIKey=LVONUTYSUPRVRZ-UHFFFAOYSA-N
Formula: C19H18O7
Molecular Weight: 358.34275
Exact Mass: 358.105253
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Krishnaveni, K.S., Rao, J.V. Phytochemistry (2000) 53, 605-6
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 155.9 |
| 3 (C) | 124.9 |
| 4 (C) | 182.5 |
| 5 (CH) | 100 |
| 6 (C) | 164.5 |
| 7 (C) | 165.6 |
| 8 (CH) | 95.7 |
| 9 (C) | 159.7 |
| 10 (C) | 106 |
| 1' (C) | 112.7 |
| 2' (C) | 154 |
| 3' (CH) | 100 |
| 4' (C) | 152.4 |
| 5' (C) | 144.5 |
| 6' (CH) | 118.2 |
| 7a (CH3) | 57.8 |
| 2'a (CH3) | 57.6 |
| 4'a (CH3) | 57.4 |
| 5'a (CH3) | 57.1 |