Common Name: Alpinumisoflavone
Synonyms: Alpinumisoflavone
CAS Registry Number:
InChI: InChI=1S/C20H16O5/c1-20(2)8-7-13-15(25-20)9-16-17(18(13)22)19(23)14(10-24-16)11-3-5-12(21)6-4-11/h3-10,21-22H,1-2H3
InChIKey: InChIKey=RQAMSFTXEFSBPK-UHFFFAOYSA-N
Formula: C20H16O5
Molecular Weight: 336.338795
Exact Mass: 336.099774
NMR Solvent: C+M
MHz:
Calibration:
NMR references: 13C - el-Masry, S., Amer, M.E., Abdel-Kader, M.S., Zaatout, H.H. Phytochemistry (2002) 60, 783-7
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 152.5 |
| 3 (C) | 123.5 |
| 4 (C) | 180.9 |
| 5 (C) | 157 |
| 6 (C) | 105.8 |
| 7 (C) | 159.3 |
| 8 (CH) | 94.8 |
| 9 (C) | 157.1 |
| 10 (C) | 105.3 |
| 1' (C) | 121.6 |
| 2' (CH) | 130 |
| 3' (CH) | 115.3 |
| 4' (C) | 156.2 |
| 5' (CH) | 115.3 |
| 6' (CH) | 130 |
| 2'' (C) | 77.8 |
| 3'' (CH) | 128.1 |
| 4'' (CH) | 115.1 |
| 5'' (CH3) | 27.9 |
| 6'' (CH3) | 27.9 |