Common Name: Erypoegin D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H24O6/c1-12(2)5-6-13-7-15(19(27-4)10-17(13)23)16-11-28-20-9-14(26-3)8-18(24)21(20)22(16)25/h5,7-10,16,23-24H,6,11H2,1-4H3
InChIKey: InChIKey=RGXQEROHDTYEQG-UHFFFAOYSA-N
Formula: C22H24O6
Molecular Weight: 384.423197
Exact Mass: 384.157289
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Shimizu, H., Tateishi, Y. Phytochemistry (2002) 60, 789-94
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 70.5 |
| 3 (CH) | 46.9 |
| 4 (C) | 197.6 |
| 5 (C) | 164.5 |
| 6 (CH) | 94.9 |
| 7 (C) | 167.6 |
| 8 (CH) | 93.9 |
| 9 (C) | 163.3 |
| 10 (C) | 103.5 |
| 1' (C) | 114.4 |
| 2' (C) | 156.9 |
| 3' (CH) | 100.2 |
| 4' (C) | 155.3 |
| 5' (C) | 118.5 |
| 6' (CH) | 131.4 |
| 1'' (CH2) | 29.2 |
| 2'' (CH) | 121.8 |
| 3'' (C) | 135 |
| 4'' (CH3) | 25.7 |
| 5'' (CH3) | 17.8 |
| 7a (CH3) | 55.7 |
| 2'a (CH3) | 55.6 |