Common Name: Erypoegin E
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H18O4/c1-11(2)3-5-14-17(22)8-7-15-19(14)23-10-16-13-6-4-12(21)9-18(13)24-20(15)16/h3-4,6-9,21-22H,5,10H2,1-2H3
InChIKey: InChIKey=VREXGHBHPUSDKC-UHFFFAOYSA-N
Formula: C20H18O4
Molecular Weight: 322.355271
Exact Mass: 322.120509
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Shimizu, H., Tateishi, Y. Phytochemistry (2002) 60, 789-94
Species:
Notes: Family : Flavonoids, Type : Pterocarpanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 118.8 |
| 2 (CH) | 108.7 |
| 3 (C) | 155.9 |
| 4 (C) | 115.4 |
| 4a (C) | 152.1 |
| 6 (CH2) | 65.4 |
| 6a (C) | 105.4 |
| 6b (C) | 119.7 |
| 7 (CH) | 118.5 |
| 8 (CH) | 111.9 |
| 9 (C) | 153.2 |
| 10 (CH) | 98.9 |
| 10a (C) | 156.2 |
| 11a (C) | 148.1 |
| 11b (C) | 109.8 |
| 1' (CH2) | 22.6 |
| 2' (CH) | 121.5 |
| 3' (C) | 134.7 |
| 4' (CH3) | 25.8 |
| 5' (CH3) | 17.9 |