Common Name: Erypoegin G
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H22O6/c1-22(2)6-5-12-7-14(18(26-4)10-17(12)28-22)15-11-27-19-9-13(25-3)8-16(23)20(19)21(15)24/h5-10,15,23H,11H2,1-4H3
InChIKey: InChIKey=QXPUHSMJCUBFPG-UHFFFAOYSA-N
Formula: C22H22O6
Molecular Weight: 382.407316
Exact Mass: 382.141638
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Sako, M., Sato, M., Fukai, T., Tateishi, Y. Phytochemistry (2003) 63, 597-602
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 70.6 |
| 3 (CH) | 46.6 |
| 4 (C) | 197.4 |
| 5 (C) | 164.5 |
| 6 (CH) | 94.9 |
| 7 (C) | 167.6 |
| 8 (CH) | 94 |
| 9 (C) | 163.2 |
| 10 (C) | 103.5 |
| 1' (C) | 114.3 |
| 2' (C) | 158.1 |
| 3' (CH) | 100.2 |
| 4' (C) | 154 |
| 5' (C) | 114.6 |
| 6' (CH) | 127.9 |
| 2'' (C) | 76.7 |
| 3'' (CH) | 127.8 |
| 4'' (CH) | 121.6 |
| 5'' (CH3) | 28.2 |
| 6'' (CH3) | 28.2 |
| 7a (CH3) | 55.6 |
| 2'a (CH3) | 55.7 |