Common Name: Uncinanone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H18O6/c1-9(2)15-6-12-16(26-15)7-17-18(19(12)23)20(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7,13,15,21-23H,1,6,8H2,2H3
InChIKey: InChIKey=MWILFHFRKVPOMC-UHFFFAOYSA-N
Formula: C20H18O6
Molecular Weight: 354.354081
Exact Mass: 354.110338
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tsanuo, M.K., Hassanali, A., Hooper, A.M., Khan, Z., Kaberia, F., Pickett, J.A., Wadhams, L.J. Phytochemistry (2003) 64, 265-73
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 69.7 |
| 3 (CH) | 45 |
| 4 (C) | 196.7 |
| 5 (C) | 159.5 |
| 6 (C) | 106.5 |
| 7 (C) | 170.2 |
| 8 (CH) | 91 |
| 9 (C) | 164.4 |
| 10 (C) | 101.6 |
| 1' (C) | 115.5 |
| 2' (C) | 156.9 |
| 3' (CH) | 105.7 |
| 4' (C) | 156.9 |
| 5' (CH) | 108.8 |
| 6' (CH) | 128.9 |
| 2'' (CH) | 88.8 |
| 3'' (CH2) | 30.3 |
| 4'' (C) | 143.2 |
| 5'' (CH2) | 113.5 |
| 6'' (CH3) | 17.1 |