Common Name: Uncinanone C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H20O6/c1-10(2)15-7-13-17(27-15)8-18-19(20(13)23)21(24)14(9-26-18)12-5-4-11(22)6-16(12)25-3/h4-6,8,14-15,22-23H,1,7,9H2,2-3H3
InChIKey: InChIKey=HRRLYEDDDAJRSW-UHFFFAOYSA-N
Formula: C21H20O6
Molecular Weight: 368.380698
Exact Mass: 368.125988
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tsanuo, M.K., Hassanali, A., Hooper, A.M., Khan, Z., Kaberia, F., Pickett, J.A., Wadhams, L.J. Phytochemistry (2003) 64, 265-73
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 70 |
| 3 (CH) | 47 |
| 4 (C) | 197.9 |
| 5 (C) | 159.7 |
| 6 (C) | 105.7 |
| 7 (C) | 169.3 |
| 8 (CH) | 90.7 |
| 9 (C) | 164.5 |
| 10 (C) | 104.7 |
| 1' (C) | 115.2 |
| 2' (C) | 159.2 |
| 3' (CH) | 100 |
| 4' (C) | 157.9 |
| 5' (CH) | 108 |
| 6' (CH) | 131.3 |
| 2'' (CH) | 88.7 |
| 3'' (CH2) | 30.7 |
| 4'' (C) | 143.5 |
| 5'' (CH2) | 113.2 |
| 6'' (CH3) | 17.4 |
| 2'a (CH3) | 56 |