Common Name: Eryzerin A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O5/c1-14(2)5-7-17-21(26)11-9-16(23(17)28)20-13-30-25-18(8-6-15(3)4)22(27)12-10-19(25)24(20)29/h5-6,9-12,20,26-28H,7-8,13H2,1-4H3
InChIKey: InChIKey=XQNULGVMJUJZML-UHFFFAOYSA-N
Formula: C25H28O5
Molecular Weight: 408.487763
Exact Mass: 408.193674
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Sako, M., Asai, F., Fukai, T., Sato, M., Murata, J., Tateishi, Y. Phytochemistry (2003) 64, 753-8
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 71 |
| 3 (CH) | 46.5 |
| 4 (C) | 193.9 |
| 5 (CH) | 127.4 |
| 6 (CH) | 111 |
| 7 (C) | 163.1 |
| 8 (C) | 116.4 |
| 9 (C) | 162.2 |
| 10 (C) | 113.6 |
| 1' (C) | 115.8 |
| 2' (C) | 155.3 |
| 3' (C) | 117.2 |
| 4' (C) | 156.4 |
| 5' (CH) | 108.3 |
| 6' (CH) | 125.6 |
| 1'' (CH2) | 22.5 |
| 2'' (CH) | 123 |
| 3'' (C) | 131.9 |
| 4'' (CH3) | 17.9 |
| 5'' (CH3) | 25.9 |
| 1''' (CH2) | 23.3 |
| 2''' (CH) | 124.1 |
| 3''' (C) | 131.1 |
| 4''' (CH3) | 17.9 |
| 5''' (CH3) | 25.9 |