Common Name: Eryzerin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O5/c1-15(2)6-8-17-12-21-25(29)22(19-11-9-18(27)13-23(19)30-5)14-31-26(21)20(24(17)28)10-7-16(3)4/h6-7,9,11-13,22,27-28H,8,10,14H2,1-5H3/t22-/m0/s1
InChIKey: InChIKey=YECSENDGXURKQA-QFIPXVFZSA-N
Formula: C26H30O5
Molecular Weight: 422.514381
Exact Mass: 422.209324
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Sako, M., Asai, F., Fukai, T., Sato, M., Murata, J., Tateishi, Y. Phytochemistry (2003) 64, 753-8
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 72 |
| 3 (CH) | 47.9 |
| 4 (C) | 191.8 |
| 5 (CH) | 125.9 |
| 6 (C) | 122.9 |
| 7 (C) | 159.6 |
| 8 (C) | 116.4 |
| 9 (C) | 160.4 |
| 10 (C) | 116 |
| 1' (C) | 116.3 |
| 2' (C) | 159.5 |
| 3' (CH) | 100.2 |
| 4' (C) | 158.9 |
| 5' (CH) | 107.9 |
| 6' (CH) | 131.5 |
| 1'' (CH2) | 28.8 |
| 2'' (CH) | 122.8 |
| 3'' (C) | 133.6 |
| 4'' (CH3) | 17.8 |
| 5'' (CH3) | 25.8 |
| 1''' (CH2) | 22.8 |
| 2''' (CH) | 123.1 |
| 3''' (C) | 132.3 |
| 4''' (CH3) | 17.9 |
| 5''' (CH3) | 25.9 |
| 2'a (CH3) | 55.8 |