Common Name: Eryzerin C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H30O4/c1-15(2)5-7-17-11-18-12-19(21-10-8-20(26)13-23(21)27)14-29-25(18)22(24(17)28)9-6-16(3)4/h5-6,8,10-11,13,19,26-28H,7,9,12,14H2,1-4H3/t19-/m0/s1
InChIKey: InChIKey=AVUGPESHBVLBAI-IBGZPJMESA-N
Formula: C25H30O4
Molecular Weight: 394.50424
Exact Mass: 394.214409
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Sako, M., Asai, F., Fukai, T., Sato, M., Murata, J., Tateishi, Y. Phytochemistry (2003) 64, 753-8
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 69.9 |
| 3 (CH) | 31.7 |
| 4 (CH2) | 30.8 |
| 5 (CH) | 127.6 |
| 6 (C) | 119.6 |
| 7 (C) | 151.6 |
| 8 (C) | 114.8 |
| 9 (C) | 150.7 |
| 10 (C) | 113.9 |
| 1' (C) | 120.3 |
| 2' (C) | 154.5 |
| 3' (CH) | 103.1 |
| 4' (C) | 155.1 |
| 5' (CH) | 107.8 |
| 6' (CH) | 128.3 |
| 1'' (CH2) | 29 |
| 2'' (CH) | 122.7 |
| 3'' (C) | 133.5 |
| 4'' (CH3) | 17.8 |
| 5'' (CH3) | 25.8 |
| 1''' (CH2) | 22.5 |
| 2''' (CH) | 122.4 |
| 3''' (C) | 133.7 |
| 4''' (CH3) | 17.8 |
| 5''' (CH3) | 25.8 |