Common Name: Eryzerin E
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O5/c1-15(2)6-8-17-21(27)12-10-19-23(17)30-14-26(28)20-11-13-22(29-5)18(9-7-16(3)4)24(20)31-25(19)26/h6-7,10-13,25,27-28H,8-9,14H2,1-5H3/t25-,26+/m0/s1
InChIKey: InChIKey=XOWMUIMFYAHWQD-IZZNHLLZSA-N
Formula: C26H30O5
Molecular Weight: 422.514381
Exact Mass: 422.209324
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tanaka, H., Oh-Uchi, T., Etoh, H., Sako, M., Asai, F., Fukai, T., Sato, M., Murata, J., Tateishi, Y. Phytochemistry (2003) 64, 753-8
Species:
Notes: Family : Flavonoids, Type : Pterocarpanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 129.5 |
| 2 (CH) | 110.4 |
| 3 (C) | 155.8 |
| 4 (C) | 114.8 |
| 4a (C) | 153.1 |
| 6 (CH2) | 70 |
| 6a (C) | 76.8 |
| 6b (C) | 120.6 |
| 7 (CH) | 120.7 |
| 8 (CH) | 103.8 |
| 9 (C) | 159.8 |
| 10 (C) | 113.6 |
| 10a (C) | 158.6 |
| 11a (CH) | 84.8 |
| 11b (C) | 112.8 |
| 1' (CH2) | 22.4 |
| 2' (CH) | 121.6 |
| 3' (C) | 134.9 |
| 4' (CH3) | 17.8 |
| 5' (CH3) | 25.8 |
| 1'' (CH2) | 22.5 |
| 2'' (CH) | 121.9 |
| 3'' (C) | 131.7 |
| 4'' (CH3) | 17.7 |
| 5'' (CH3) | 25.8 |
| 9a (CH3) | 56 |