Common Name: 3',4',5,7-Tetrahydroxy-2',5'-di(3-methyl-2-butenyl)isoflavone
Synonyms: 3',4',5,7-Tetrahydroxy-2',5'-di(3-methyl-2-butenyl)isoflavone
CAS Registry Number:
InChI: InChI=1S/C25H26O6/c1-13(2)5-7-15-9-18(17(8-6-14(3)4)25(30)23(15)28)19-12-31-21-11-16(26)10-20(27)22(21)24(19)29/h5-6,9-12,26-28,30H,7-8H2,1-4H3
InChIKey: InChIKey=RWGZXUWGOARVDQ-UHFFFAOYSA-N
Formula: C25H26O6
Molecular Weight: 422.471287
Exact Mass: 422.172939
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ahn, E.M., Nakamura, N., Akao, T., Komatsu, K., Qui, M.H., Hattori, M. Phytochemistry (2003) 64, 1389-94
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 153.9 |
| 3 (C) | 124.4 |
| 4 (C) | 181.2 |
| 5 (C) | 162.7 |
| 6 (CH) | 99.5 |
| 7 (C) | 162.3 |
| 8 (CH) | 94.1 |
| 9 (C) | 158.2 |
| 10 (C) | 105.9 |
| 1' (C) | 121.5 |
| 2' (C) | 124.9 |
| 3' (C) | 142.5 |
| 4' (C) | 143.1 |
| 5' (C) | 125.4 |
| 6' (CH) | 123.4 |
| 1'' (CH2) | 27.7 |
| 2'' (CH) | 122.2 |
| 3'' (C) | 134.6 |
| 4'' (CH3) | 25.7 |
| 5'' (CH3) | 17.8 |
| 1''' (CH2) | 28.7 |
| 2''' (CH) | 121.8 |
| 3''' (C) | 134.2 |
| 4''' (CH3) | 25.8 |
| 5''' (CH3) | 17.8 |