Common Name: Pongapinnol B
Synonyms: Pongapinnol B
CAS Registry Number:
InChI: InChI=1S/C20H16O6/c1-22-12-8-11(9-13(10-12)23-2)18-20(24-3)17(21)15-4-5-16-14(6-7-25-16)19(15)26-18/h4-10H,1-3H3
InChIKey: InChIKey=RSTRBTNSRVARGB-UHFFFAOYSA-N
Formula: C20H16O6
Molecular Weight: 352.3382
Exact Mass: 352.094688
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Yadav, P.P., Ahmad, G., Maurya, R. Phytochemistry (2004) 65, 439-43
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.5 |
| 3 (C) | 142.3 |
| 4 (C) | 175.3 |
| 5 (CH) | 122.2 |
| 6 (CH) | 110.3 |
| 7 (C) | 154.9 |
| 8 (C) | 117.3 |
| 9 (C) | 150.2 |
| 10 (C) | 120 |
| 1' (C) | 132.9 |
| 2' (CH) | 107 |
| 3' (C) | 161.1 |
| 4' (CH) | 103 |
| 5' (C) | 161.1 |
| 6' (CH) | 107 |
| 2'' (CH) | 146.1 |
| 3'' (CH) | 104.6 |
| 3a (CH3) | 60.6 |
| 3'a (CH3) | 55.9 |
| 5'a (CH3) | 55.9 |