Common Name: 5,5''-Dihydroxy-6,4',6'',3''',4'''-pentamethoxy-[C7–O–C7'']-biflavone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C35H28O12/c1-40-19-9-6-17(7-10-19)23-13-20(36)30-26(45-23)15-28(34(43-4)32(30)38)47-29-16-27-31(33(39)35(29)44-5)21(37)14-24(46-27)18-8-11-22(41-2)25(12-18)42-3/h6-16,38-39H,1-5H3
InChIKey: InChIKey=HKASFPMHCIAWIJ-UHFFFAOYSA-N
Formula: C35H28O12
Molecular Weight: 640.590957
Exact Mass: 640.158076
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Barbosa, F.G., Lima, M.A., Silveira, E.R. Magn Reson Chem (2005) 43, 334-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.6 |
| 3 (CH) | 104.4 |
| 4 (C) | 183.4 |
| 5 (C) | 152.5 |
| 6 (C) | 130.7 |
| 7 (C) | 153.5 |
| 8 (CH) | 93.8 |
| 9 (C) | 155.4 |
| 10 (C) | 106.1 |
| 1' (C) | 124.2 |
| 2' (CH) | 128.4 |
| 3' (CH) | 114.9 |
| 4' (C) | 163 |
| 5' (CH) | 114.9 |
| 6' (CH) | 128.4 |
| 2'' (C) | 164.5 |
| 3'' (CH) | 104.1 |
| 4'' (C) | 183.3 |
| 5'' (C) | 152.5 |
| 6'' (C) | 130.7 |
| 7'' (C) | 153.5 |
| 8'' (CH) | 93.7 |
| 9'' (C) | 155.3 |
| 10'' (C) | 106.1 |
| 1''' (C) | 123.9 |
| 2''' (CH) | 109.2 |
| 3''' (C) | 149.7 |
| 4''' (C) | 152.7 |
| 5''' (CH) | 111.6 |
| 6''' (CH) | 120.5 |
| 6a (CH3) | 61.3 |
| 4'a (CH3) | 55.9 |
| 6''a (CH3) | 61.4 |
| 3'''a (CH3) | 56.5 |
| 4'''a (CH3) | 56.5 |