Common Name: Naringenin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C31H24O10/c1-38-19-11-22(35)31-24(37)14-26(41-29(31)12-19)16-4-7-20(33)27(8-16)39-18-5-2-15(3-6-18)25-13-23(36)30-21(34)9-17(32)10-28(30)40-25/h2-12,25-26,32-35H,13-14H2,1H3/t25-,26+/m1/s1
InChIKey: InChIKey=RTASEZGPNDVJDB-FTJBHMTQSA-N
Formula: C31H24O10
Molecular Weight: 556.51744
Exact Mass: 556.136947
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Jayaprakasam, B., Damu, A.G., Rao, K.V., Gunasekar, D., Blond, A., Bodo, B. J Nat Prod (2000) 63, 507-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 79.5 |
| 3 (CH2) | 43.5 |
| 4 (C) | 197.4 |
| 5 (C) | 165 |
| 6 (CH) | 95.6 |
| 7 (C) | 168.3 |
| 8 (CH) | 94.6 |
| 9 (C) | 164 |
| 10 (C) | 103.7 |
| 1' (C) | 132 |
| 2' (CH) | 121 |
| 3' (C) | 143.6 |
| 4' (C) | 150.5 |
| 5' (CH) | 118.2 |
| 6' (CH) | 124.9 |
| 2'' (CH) | 79.4 |
| 3'' (CH2) | 43.5 |
| 4'' (C) | 196.9 |
| 5'' (C) | 165.3 |
| 6'' (CH) | 96.9 |
| 7'' (C) | 167.4 |
| 8'' (CH) | 95.9 |
| 9'' (C) | 164.2 |
| 10'' (C) | 103.2 |
| 1''' (C) | 134 |
| 2''' (CH) | 129 |
| 3''' (CH) | 117.4 |
| 4''' (C) | 159.2 |
| 5''' (CH) | 117.4 |
| 6''' (CH) | 129 |
| 7a (CH3) | 56.2 |