Common Name: Linaroside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24O11/c1-30-11-5-3-10(4-6-11)13-7-12(25)17-14(32-13)8-15(22(31-2)19(17)27)33-23-21(29)20(28)18(26)16(9-24)34-23/h3-8,16,18,20-21,23-24,26-29H,9H2,1-2H3/t16-,18-,20+,21-,23-/m1/s1
InChIKey: InChIKey=JNNRILAYMZYEQB-FZFRBNDOSA-N
Formula: C23H24O11
Molecular Weight: 476.430958
Exact Mass: 476.131862
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Begum, S., Wahab, A., Siddiqui, B.S., Qamar, F. J Nat Prod (2000) 63, 765-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 163.8 |
| 3 (CH) | 103.3 |
| 4 (C) | 182.3 |
| 5 (C) | 152.4 |
| 6 (C) | 132.6 |
| 7 (C) | 156.5 |
| 8 (CH) | 94.4 |
| 9 (C) | 152.1 |
| 10 (C) | 105.8 |
| 1' (C) | 122.8 |
| 2' (CH) | 128.3 |
| 3' (CH) | 114.6 |
| 4' (C) | 162.4 |
| 5' (CH) | 114.6 |
| 6' (CH) | 128.3 |
| 1'' (CH) | 100.2 |
| 2'' (CH) | 73.2 |
| 3'' (CH) | 76.7 |
| 4'' (CH) | 69.6 |
| 5'' (CH) | 77.3 |
| 6'' (CH2) | 60.7 |
| 6a (CH3) | 60.3 |
| 4'a (CH3) | 55.6 |