Common Name: 6,8-Diprenylaromadendrin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)5-11-17-20(27)18(12-6-14(3)4)25-19(21(17)28)22(29)23(30)24(31-25)15-7-9-16(26)10-8-15/h5-10,23-24,26-28,30H,11-12H2,1-4H3/t23-,24+/m0/s1
InChIKey: InChIKey=KITBJDQJTLGBAY-BJKOFHAPSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Meragelman, K.M., McKee, T.C., Boyd, M.R. J Nat Prod (2001) 64, 546-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 82.9 |
| 3 (CH) | 72.6 |
| 4 (C) | 196.3 |
| 5 (C) | 158.8 |
| 6 (C) | 107.9 |
| 7 (C) | 163.2 |
| 8 (C) | 107 |
| 9 (C) | 157.8 |
| 10 (C) | 100.4 |
| 1' (C) | 128.4 |
| 2' (CH) | 128.9 |
| 3' (CH) | 115.5 |
| 4' (C) | 156.4 |
| 5' (CH) | 115.5 |
| 6' (CH) | 128.9 |
| 1'' (CH2) | 21.3 |
| 2'' (CH) | 121.4 |
| 3'' (C) | 134.9 |
| 4'' (CH3) | 25.81 |
| 5'' (CH3) | 17.9 |
| 1''' (CH2) | 21.7 |
| 2''' (CH) | 121.5 |
| 3''' (C) | 134.4 |
| 4''' (CH3) | 25.79 |
| 5''' (CH3) | 17.8 |