Common Name: alpha,alpha'-Dihydro-3,5,4'-trihydroxy-4,5'-diisopentenylstilbene
Synonyms: alpha,alpha'-Dihydro-3,5,4'-trihydroxy-4,5'-diisopentenylstilbene
CAS Registry Number:
InChI: InChI=1S/C24H30O3/c1-16(2)5-10-20-13-18(9-12-22(20)25)7-8-19-14-23(26)21(24(27)15-19)11-6-17(3)4/h5-6,9,12-15,25-27H,7-8,10-11H2,1-4H3
InChIKey: InChIKey=UMBTUNCDJTWDLW-UHFFFAOYSA-N
Formula: C24H30O3
Molecular Weight: 366.494099
Exact Mass: 366.219495
NMR Solvent:
MHz:
Calibration:
NMR references: 13C - Biondi, D.M., Rocco, C., Ruberto, G. J Nat Prod (2003) 66, 477-80
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 142.1 |
| 2 (CH) | 108 |
| 3 (C) | 155.2 |
| 4 (C) | 111.5 |
| 5 (C) | 155.2 |
| 6 (CH) | 108 |
| α (CH2) | 37.1 |
| β (CH2) | 38.2 |
| 1' (C) | 134.6 |
| 2' (CH) | 127.6 |
| 3' (CH) | 116.1 |
| 4' (C) | 152.7 |
| 5' (C) | 127.2 |
| 6' (CH) | 130.4 |
| 4a (CH2) | 22.8 |
| 4b (CH) | 122.4 |
| 4c (C) | 135 |
| 4d (CH3) | 26.2 |
| 4ca (CH3) | 18.3 |
| 5'a (CH2) | 30.2 |
| 5'b (CH) | 122.3 |
| 5'c (C) | 135.5 |
| 5'd (CH3) | 26.2 |
| 5'e (CH3) | 18.3 |