Common Name: alpha,beta-Dihydro-3,5,3',4'-tetrahydroxy-4,5'-diisopentenylstilbene
Synonyms: alpha,beta-Dihydro-3,5,3',4'-tetrahydroxy-4,5'-diisopentenylstilbene
CAS Registry Number:
InChI: InChI=1S/C24H30O4/c1-15(2)5-9-19-11-17(14-23(27)24(19)28)7-8-18-12-21(25)20(22(26)13-18)10-6-16(3)4/h5-6,11-14,25-28H,7-10H2,1-4H3
InChIKey: InChIKey=JRPUARBDPKCBGO-UHFFFAOYSA-N
Formula: C24H30O4
Molecular Weight: 382.493504
Exact Mass: 382.214409
NMR Solvent:
MHz:
Calibration:
NMR references: 13C - Biondi, D.M., Rocco, C., Ruberto, G. J Nat Prod (2003) 66, 477-80
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 141.6 |
| 2 (CH) | 108.2 |
| 3 (C) | 154.8 |
| 4 (C) | 111 |
| 5 (C) | 154.8 |
| 6 (CH) | 108.2 |
| α (CH2) | 37.6 |
| β (CH2) | 37.9 |
| 1' (C) | 134.2 |
| 2' (CH) | 113.1 |
| 3' (C) | 140.8 |
| 4' (C) | 143 |
| 5' (C) | 127.3 |
| 6' (CH) | 121.2 |
| 4a (CH2) | 22.3 |
| 4b (CH) | 122 |
| 4c (C) | 134.5 |
| 4d (CH3) | 25.8 |
| 4e (CH3) | 17.8 |
| 5'a (CH2) | 29.6 |
| 5'b (CH) | 121.8 |
| 5'c (C) | 135 |
| 5'd (CH3) | 25.8 |
| 5'e (CH3) | 17.8 |