Common Name: Biflavanone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C32H26O10/c1-38-19-10-22(34)31-24(36)14-26(41-29(31)12-19)16-3-6-18(7-4-16)40-28-9-17(5-8-21(28)33)27-15-25(37)32-23(35)11-20(39-2)13-30(32)42-27/h3-13,26-27,33-35H,14-15H2,1-2H3/t26-,27+/m0/s1
InChIKey: InChIKey=ILTSXACDAGDHTJ-RRPNLBNLSA-N
Formula: C32H26O10
Molecular Weight: 570.544058
Exact Mass: 570.152597
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Ariyasena, J., Baek, S.H., Perry, N.B., Weavers, R.T. J Nat Prod (2004) 67, 693-6
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 79.5 |
| 3 (CH2) | 43.4 |
| 4 (C) | 197.36 |
| 5 (C) | 164.9 |
| 6 (CH) | 94.6 |
| 7 (C) | 168.8 |
| 8 (CH) | 95.5 |
| 9 (C) | 163.9 |
| 10 (C) | 103.7 |
| 1' (C) | 131.8 |
| 2' (CH) | 121.1 |
| 3' (C) | 143.6 |
| 4' (C) | 150.7 |
| 5' (CH) | 118.2 |
| 6' (CH) | 124.9 |
| 2'' (CH) | 79.7 |
| 3'' (CH2) | 43.5 |
| 4'' (C) | 197.39 |
| 5'' (C) | 165 |
| 6'' (CH) | 94.64 |
| 7'' (C) | 168.9 |
| 8'' (CH) | 95.6 |
| 9'' (C) | 164 |
| 10'' (C) | 103.7 |
| 1''' (C) | 133.7 |
| 2''' (CH) | 129 |
| 3''' (CH) | 117.4 |
| 4''' (C) | 159.3 |
| 5''' (CH) | 117.4 |
| 6''' (CH) | 129 |
| 7a (CH3) | 56.3 |
| 7''a (CH3) | 56.3 |