Common Name: Artochamin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H24O7/c1-11(2)5-6-13-15(26)9-18(29)21-23(30)22-20(7-12(3)4)31-19-10-17(28)16(27)8-14(19)25(22)32-24(13)21/h5,7-10,20,26-29H,6H2,1-4H3
InChIKey: InChIKey=HEXPWLIZWQZUCB-UHFFFAOYSA-N
Formula: C25H24O7
Molecular Weight: 436.45481
Exact Mass: 436.152203
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Wang, Y.H., Hou, A.J., Chen, L., Chen, D.F., Sun, H.D., Zhao, Q.S., Bastow, K.F., Nakanish, Y., Wang, X.H., Lee, K.H. J Nat Prod (2004) 67, 757-61
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 156.7 |
| 3 (C) | 109.9 |
| 4 (C) | 179.4 |
| 5 (C) | 161 |
| 6 (CH) | 99.4 |
| 7 (C) | 161.9 |
| 8 (C) | 107.5 |
| 9 (C) | 155.2 |
| 10 (C) | 105.6 |
| 1' (C) | 107.9 |
| 2' (C) | 152.1 |
| 3' (CH) | 105.4 |
| 4' (C) | 152.3 |
| 5' (C) | 141.4 |
| 6' (CH) | 110 |
| 3a (CH) | 69.9 |
| 3b (CH) | 122.2 |
| 3c (C) | 138.4 |
| 3d (CH3) | 25.9 |
| 3e (CH3) | 18.6 |
| 8a (CH2) | 22.3 |
| 8b (CH) | 123.4 |
| 8c (C) | 132.1 |
| 8d (CH3) | 25.9 |
| 8e (CH3) | 18.1 |