Common Name: (S)-2,3-Dihydro-5,7-dihydroxy-2-phenyl-6,8-diprenyl-4H-1-benzopyran-4-one
Synonyms: (S)-2,3-Dihydro-5,7-dihydroxy-2-phenyl-6,8-diprenyl-4H-1-benzopyran-4-one
CAS Registry Number:
InChI: InChI=1S/C25H28O4/c1-15(2)10-12-18-23(27)19(13-11-16(3)4)25-22(24(18)28)20(26)14-21(29-25)17-8-6-5-7-9-17/h5-11,21,27-28H,12-14H2,1-4H3/t21-/m0/s1
InChIKey: InChIKey=UXCSTUMJYCXTOV-NRFANRHFSA-N
Formula: C25H28O4
Molecular Weight: 392.488358
Exact Mass: 392.198759
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Borges-Argaez, R., Penia-Rodriguez, L.M., Waterman, P.G. Phytochemistry (2000) 54, 611-4
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 79 |
| 3 (CH2) | 43.7 |
| 4 (C) | 196.4 |
| 5 (C) | 159.5 |
| 6 (C) | 107.5 |
| 7 (C) | 162.5 |
| 8 (C) | 106.7 |
| 9 (C) | 157.8 |
| 10 (C) | 103 |
| 1' (C) | 139.1 |
| 2' (CH) | 129 |
| 3' (CH) | 126.2 |
| 4' (CH) | 128.7 |
| 5' (CH) | 126.2 |
| 6' (CH) | 129 |
| 6a (CH2) | 21.5 |
| 6b (CH) | 122 |
| 6c (C) | 134.2 |
| 6d (CH3) | 26 |
| 6ca (CH3) | 18 |
| 8a (CH2) | 22.2 |
| 8b (CH) | 122.2 |
| 8c (C) | 135 |
| 8d (CH3) | 26.1 |
| 8ca (CH3) | 18.1 |