Common Name: 2,4'-Dihydroxy-4-methoxy-6-(beta-D-glucopyranosyloxy)benzophenone
Synonyms: 2,4'-Dihydroxy-4-methoxy-6-(beta-D-glucopyranosyloxy)benzophenone
CAS Registry Number:
InChI: InChI=1S/C20H22O10/c1-28-11-6-12(23)15(16(24)9-2-4-10(22)5-3-9)13(7-11)29-20-19(27)18(26)17(25)14(8-21)30-20/h2-7,14,17-23,25-27H,8H2,1H3/t14-,17-,18+,19-,20-/m1/s1
InChIKey: InChIKey=LCZPALDWQFYTCU-LWUBGYQZSA-N
Formula: C20H22O10
Molecular Weight: 422.383464
Exact Mass: 422.121297
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Ferrari, J., Terreaux, C., Sahpaz, S., Msonthi, J.D., Wolfender, J.L., Hostettmann, K. Phytochemistry (2000) 54, 883-9
Species:
Notes: Family : Aromatics, Type : Benzophenones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 131.02 |
| 2 (CH) | 132.87 |
| 3 (CH) | 115.31 |
| 4 (C) | 163.45 |
| 5 (CH) | 115.31 |
| 6 (CH) | 132.87 |
| 1' (C) | 111.05 |
| 2' (C) | 157.71 |
| 3' (CH) | 94.22 |
| 4' (C) | 163.52 |
| 5' (CH) | 96.09 |
| 6' (C) | 158.29 |
| 7' (C) | 196.34 |
| 1'' (CH) | 101.79 |
| 2'' (CH) | 74.06 |
| 3'' (CH) | 77.12 |
| 4'' (CH) | 70.55 |
| 5'' (CH) | 77.6 |
| 6'' (CH2) | 61.89 |
| 4'a (CH3) | 55.24 |