Common Name: Kaempferol 7-O-(6-trans-caffeoyl)-β--Dglucopyranosyl-(1-->3)-α-L-rhamnopyranoside-3-O-β-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C42H46O23/c1-15-28(49)38(64-41-35(56)33(54)30(51)25(63-41)14-58-26(48)9-3-16-2-8-20(45)21(46)10-16)36(57)42(59-15)60-19-11-22(47)27-23(12-19)61-37(17-4-6-18(44)7-5-17)39(31(27)52)65-40-34(55)32(53)29(50)24(13-43)62-40/h2-12,15,24-25,28-30,32-36,38,40-47,49-51,53-57H,13-14H2,1H3/b9-3+/t15-,24+,25+,28-,29+,30+,32-,33-,34+,35+,36+,38+,40-,41-,42-/m0/s1
InChIKey: InChIKey=ZFAHFNHITMYOLF-KBHLDNDPSA-N
Formula: C42H46O23
Molecular Weight: 918.802496
Exact Mass: 918.242988
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fico, G., Braca, A., De Tommasi, N., Tome, F., Morelli, I. Phytochemistry (2001) 57, 543-6
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.9 |
| 3 (C) | 136 |
| 4 (C) | 179.5 |
| 5 (C) | 162.5 |
| 6 (CH) | 100.1 |
| 7 (C) | 163 |
| 8 (CH) | 95.6 |
| 9 (C) | 157.3 |
| 10 (C) | 107.7 |
| 1' (C) | 123 |
| 2' (CH) | 132.6 |
| 3' (CH) | 116.1 |
| 4' (C) | 161.4 |
| 5' (CH) | 116.1 |
| 6' (CH) | 132.6 |
| 1'' (CH) | 104 |
| 2'' (CH) | 75.8 |
| 3'' (CH) | 77.8 |
| 4'' (CH) | 71.5 |
| 5'' (CH) | 78.3 |
| 6'' (CH2) | 62.8 |
| 1''' (CH) | 99.1 |
| 2''' (CH) | 71.9 |
| 3''' (CH) | 83.6 |
| 4''' (CH) | 72.7 |
| 5''' (CH) | 71.4 |
| 6''' (CH3) | 18.2 |
| 1'''' (CH) | 106.4 |
| 2'''' (CH) | 75.8 |
| 3'''' (CH) | 78.2 |
| 4'''' (CH) | 75.2 |
| 5'''' (CH) | 75.8 |
| 6'''' (CH2) | 64.8 |
| 1''''' (C) | 169 |
| 2''''' (CH) | 114.6 |
| 3''''' (CH) | 147.3 |
| 4''''' (C) | 127.2 |
| 5''''' (CH) | 114.6 |
| 6''''' (C) | 149.6 |
| 7''''' (C) | 145.6 |
| 8''''' (CH) | 122.9 |
| 9''''' (CH) | 123.8 |