Common Name: Kaempferol 7-O-(6-trans-p-coumaroyl)-β-D-glucopyranosyl-(1-->3)-α-L-rhamnopyranoside-3-O-β-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C42H46O22/c1-16-28(48)38(63-41-35(55)33(53)30(50)25(62-41)15-57-26(47)11-4-17-2-7-19(44)8-3-17)36(56)42(58-16)59-21-12-22(46)27-23(13-21)60-37(18-5-9-20(45)10-6-18)39(31(27)51)64-40-34(54)32(52)29(49)24(14-43)61-40/h2-13,16,24-25,28-30,32-36,38,40-46,48-50,52-56H,14-15H2,1H3/b11-4+/t16-,24+,25+,28-,29+,30+,32-,33-,34+,35+,36+,38+,40-,41-,42-/m0/s1
InChIKey: InChIKey=CYMIHPZMEGGNPY-LFTZDLSMSA-N
Formula: C42H46O22
Molecular Weight: 902.803091
Exact Mass: 902.248073
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fico, G., Braca, A., De Tommasi, N., Tome, F., Morelli, I. Phytochemistry (2001) 57, 543-6
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.8 |
| 3 (C) | 135.9 |
| 4 (C) | 179.7 |
| 5 (C) | 162.7 |
| 6 (CH) | 100 |
| 7 (C) | 163.1 |
| 8 (CH) | 95.7 |
| 9 (C) | 157.8 |
| 10 (C) | 107.5 |
| 1' (C) | 122.9 |
| 2' (CH) | 132.5 |
| 3' (CH) | 116.1 |
| 4' (C) | 161.7 |
| 5' (CH) | 116.1 |
| 6' (CH) | 132.5 |
| 1'' (CH) | 104.2 |
| 2'' (CH) | 75.8 |
| 3'' (CH) | 77.8 |
| 4'' (CH) | 71.5 |
| 5'' (CH) | 78.3 |
| 6'' (CH2) | 62.8 |
| 1''' (CH) | 99.3 |
| 2''' (CH) | 72 |
| 3''' (CH) | 83.5 |
| 4''' (CH) | 72.7 |
| 5''' (CH) | 71.5 |
| 6''' (CH3) | 18.3 |
| 1'''' (CH) | 106.3 |
| 2'''' (CH) | 75.8 |
| 3'''' (CH) | 78.2 |
| 4'''' (CH) | 75.2 |
| 5'''' (CH) | 75.1 |
| 6'''' (CH2) | 64.9 |
| 1''''' (C) | 169 |
| 2''''' (CH) | 114.7 |
| 3''''' (CH) | 146.9 |
| 4''''' (C) | 126.7 |
| 5''''' (CH) | 130.9 |
| 6''''' (CH) | 116.4 |
| 7''''' (C) | 161 |
| 8''''' (CH) | 116.4 |
| 9''''' (CH) | 130.9 |