Common Name: Kaempferol 3-O-[2-O-(trans-3-methoxy-4-hydroxycinnamoyl)]-β-D-glucopyranosyl-(1-->6)-O-β-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C37H38O19/c1-50-21-10-15(2-8-19(21)41)3-9-25(43)55-35-31(48)27(44)23(13-38)53-37(35)51-14-24-28(45)30(47)32(49)36(54-24)56-34-29(46)26-20(42)11-18(40)12-22(26)52-33(34)16-4-6-17(39)7-5-16/h2-12,23-24,27-28,30-32,35-42,44-45,47-49H,13-14H2,1H3/b9-3+/t23-,24-,27-,28-,30+,31+,32-,35-,36+,37-/m1/s1
InChIKey: InChIKey=QTBAHGQXOZTLPE-ZAGNFOMMSA-N
Formula: C37H38O19
Molecular Weight: 786.68767
Exact Mass: 786.200729
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fattorusso, E., Lanzotti, V., Taglialatela-Scafati, O., Cicala, C. Phytochemistry (2001) 57, 565-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.8 |
| 3 (C) | 134 |
| 4 (C) | 179.1 |
| 5 (C) | 161.5 |
| 6 (CH) | 101 |
| 7 (C) | 163.2 |
| 8 (CH) | 96.4 |
| 9 (C) | 158 |
| 10 (C) | 105.2 |
| 1' (C) | 123.2 |
| 2' (CH) | 132.1 |
| 3' (CH) | 116.4 |
| 4' (C) | 161 |
| 5' (CH) | 116.4 |
| 6' (CH) | 132.1 |
| 1'' (CH) | 104.5 |
| 2'' (CH) | 75.7 |
| 3'' (CH) | 77.4 |
| 4'' (CH) | 73.3 |
| 5'' (CH) | 76.3 |
| 6'' (CH2) | 68.9 |
| 1''' (CH) | 102.8 |
| 2''' (CH) | 75.5 |
| 3''' (CH) | 76.5 |
| 4''' (CH) | 71.3 |
| 5''' (CH) | 79 |
| 6''' (CH2) | 62.5 |
| 1'''' (C) | 163.1 |
| 2'''' (CH) | 115.1 |
| 3'''' (CH) | 148.2 |
| 4'''' (C) | 124 |
| 5'''' (CH) | 113.2 |
| 6'''' (C) | 150.7 |
| 7'''' (C) | 152 |
| 8'''' (CH) | 116.8 |
| 9'''' (CH) | 124.6 |
| 6''''a (CH3) | 56.5 |