Common Name: Sophoraflavanone G
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3/t15?,23-/m0/s1
InChIKey: InChIKey=XRYVAQQLDYTHCL-GMTBNIFVSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Yamamoto, H., Zhao, P., Inoue, K. Phytochemistry (2002) 60, 263-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 75.3 |
| 3 (CH2) | 42.8 |
| 4 (C) | 198.2 |
| 5 (C) | 163 |
| 6 (CH) | 96.2 |
| 7 (C) | 165.3 |
| 8 (C) | 107.8 |
| 9 (C) | 162.1 |
| 10 (C) | 103.2 |
| 1' (C) | 117.8 |
| 2' (C) | 156.1 |
| 3' (CH) | 103.4 |
| 4' (C) | 159.4 |
| 5' (CH) | 107.6 |
| 6' (CH) | 128.6 |
| 1'' (CH2) | 27.8 |
| 2'' (CH) | 47.8 |
| 3'' (CH2) | 31.9 |
| 4'' (CH) | 124.4 |
| 5'' (C) | 131.6 |
| 6'' (CH3) | 25.8 |
| 7'' (CH3) | 17.8 |
| 8'' (C) | 149.1 |
| 9'' (CH2) | 111.2 |
| 10'' (CH3) | 19.1 |