Common Name: Besperuloside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24O11/c24-7-14-17(25)18(26)19(27)23(33-14)34-22-15-11(8-30-20(28)10-4-2-1-3-5-10)6-13-16(15)12(9-31-22)21(29)32-13/h1-6,9,13-19,22-27H,7-8H2/t13-,14+,15+,16-,17+,18-,19+,22-,23-/m0/s1
InChIKey: InChIKey=MTZCRZNGVPRZJE-TYYNVYBRSA-N
Formula: C23H24O11
Molecular Weight: 476.430958
Exact Mass: 476.131862
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Taskova, R.M., Gotfredsen, C.H., Jensen, S.R. Phytochemistry (2006) 67, 286-301
Species:
Notes: Family : Terpenoids, Type : Monoterpenoids, Group : Iridoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 93.5 |
| 3 (CH) | 150.3 |
| 4 (C) | 106.9 |
| 5 (CH) | 37.5 |
| 6 (CH) | 86.3 |
| 7 (CH) | 129.1 |
| 8 (C) | 144.2 |
| 9 (CH) | 45.5 |
| 10 (CH2) | 62.5 |
| 11 (C) | 172.5 |
| 1' (CH) | 100.1 |
| 2' (CH) | 74.6 |
| 3' (CH) | 77.9 |
| 4' (CH) | 71.5 |
| 5' (CH) | 78.3 |
| 6' (CH2) | 62.7 |
| 10a (C) | 167.3 |
| 10b (C) | 130.9 |
| 10c (CH) | 130.6 |
| 10d (CH) | 129.7 |
| 10e (CH) | 134.5 |
| 10f (CH) | 129.7 |
| 10g (CH) | 130.6 |