Common Name: 5'-O-Methylmyricetin 3-O-a-rhamnosyl (1'''-->2'')-arhamnoside-3'-O-b-galactoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C34H42O21/c1-9-19(38)24(43)27(46)32(49-9)55-31-26(45)20(39)10(2)50-34(31)54-30-23(42)18-13(37)6-12(36)7-14(18)51-29(30)11-4-15(48-3)21(40)16(5-11)52-33-28(47)25(44)22(41)17(8-35)53-33/h4-7,9-10,17,19-20,22,24-28,31-41,43-47H,8H2,1-3H3/t9-,10-,17+,19-,20-,22-,24+,25-,26+,27+,28+,31+,32-,33+,34-/m0/s1
InChIKey: InChIKey=SHWCEOWJSKHENJ-YKTRTIOASA-N
Formula: C34H42O21
Molecular Weight: 786.686036
Exact Mass: 786.221858
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Manguro, L.O., Wagai, S.O., Lemmen, P. Phytochemistry (2006) 67, 830-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 156.3 |
| 3 (C) | 134.6 |
| 4 (C) | 177.8 |
| 5 (C) | 161.1 |
| 6 (CH) | 99.4 |
| 7 (C) | 163.8 |
| 8 (CH) | 94.7 |
| 9 (C) | 156.8 |
| 10 (C) | 105.1 |
| 1' (C) | 121 |
| 2' (CH) | 107.1 |
| 3' (C) | 147.1 |
| 4' (C) | 137.8 |
| 5' (C) | 146.8 |
| 6' (CH) | 107.3 |
| 1'' (CH) | 101.3 |
| 2'' (CH) | 81.7 |
| 3'' (CH) | 70.5 |
| 4'' (CH) | 71.9 |
| 5'' (CH) | 69.8 |
| 6'' (CH3) | 17.8 |
| 1''' (CH) | 98.7 |
| 2''' (CH) | 70.3 |
| 3''' (CH) | 70.8 |
| 4''' (CH) | 72 |
| 5''' (CH) | 68.8 |
| 6''' (CH3) | 17.5 |
| 1'''' (CH) | 104.3 |
| 2'''' (CH) | 75.5 |
| 3'''' (CH) | 77.1 |
| 4'''' (CH) | 67.8 |
| 5'''' (CH) | 78.4 |
| 6'''' (CH2) | 62.1 |
| 5'a (CH3) | 56.8 |