Common Name: 2'-hydroxy-3,4,4' -trimethoxy-5',6'-(2'',2'-dimethylpyrano)chalcone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24O6/c1-23(2)11-10-15-19(27-4)13-17(25)21(22(15)29-23)16(24)8-6-14-7-9-18(26-3)20(12-14)28-5/h6-13,25H,1-5H3/b8-6+
InChIKey: InChIKey=MYVVQLOQHTYUSA-SOFGYWHQSA-N
Formula: C23H24O6
Molecular Weight: 396.433933
Exact Mass: 396.157289
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tomazela, D.M., Pupo, M.T., Passador, E.A., da Silva, M.F., Vieira, P.C., Fernandes, J.B., Fo, E.R., Oliva, G., Pirani, J.R. Phytochemistry (2000) 55, 643-51
Species:
Notes: Family : Flavonoids, Type : Chalconoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 128 |
| 2 (CH) | 109.4 |
| 3 (C) | 153.4 |
| 4 (C) | 149 |
| 5 (CH) | 111.1 |
| 6 (CH) | 123.3 |
| α (CH) | 125.2 |
| β (CH) | 142.6 |
| 1' (C) | 106.3 |
| 2' (C) | 167.4 |
| 3' (CH) | 92.7 |
| 4' (C) | 161.2 |
| 5' (C) | 102.9 |
| 6' (C) | 155.6 |
| β' (C) | 192.4 |
| 2'' (C) | 77.8 |
| 3'' (CH) | 124.4 |
| 4'' (CH) | 116.8 |
| 5'' (CH3) | 27.9 |
| 6'' (CH3) | 27.9 |
| 3a (CH3) | 55.8 |
| 4a (CH3) | 56.1 |
| 4'a (CH3) | 56.1 |