Common Name: 3',4',5',5,7-pentamethoxyØavone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3
InChIKey: InChIKey=GIKVSFNAEBQLGB-UHFFFAOYSA-N
Formula: C20H20O7
Molecular Weight: 372.369368
Exact Mass: 372.120903
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Tomazela, D.M., Pupo, M.T., Passador, E.A., da Silva, M.F., Vieira, P.C., Fernandes, J.B., Fo, E.R., Oliva, G., Pirani, J.R. Phytochemistry (2000) 55, 643-51
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 160.5 |
| 3 (CH) | 108.9 |
| 4 (C) | 177.5 |
| 5 (C) | 161 |
| 6 (CH) | 96.2 |
| 7 (C) | 164.1 |
| 8 (CH) | 92.9 |
| 9 (C) | 159.9 |
| 10 (C) | 109.3 |
| 1' (C) | 126.8 |
| 2' (CH) | 103.5 |
| 3' (C) | 153.6 |
| 4' (C) | 140.9 |
| 5' (C) | 153.6 |
| 6' (CH) | 103.5 |
| 5a (CH3) | 55.8 |
| 7a (CH3) | 56.4 |
| 3'a (CH3) | 56.4 |
| 4'a (CH3) | 61 |
| 5'a (CH3) | 56.4 |