Common Name: Proanthocyanidin A-1
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26+,27+,29+,30-/m0/s1
InChIKey: InChIKey=NSEWTSAADLNHNH-TXZJYACMSA-N
Formula: C30H24O12
Molecular Weight: 576.505514
Exact Mass: 576.126776
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Lou, H.X., Yamazaki, Y., Sasaki, T., Uchida, M., Tanaka, H., Oka, S. Phytochemistry (1999) 51, 297-308
Species:
Notes: Family : Flavonoids, Type : Proanthocyanidins; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 100.34 |
| 3 (CH) | 67.79 |
| 4 (CH) | 29.23 |
| 5 (C) | 156.76 |
| 6 (CH) | 98.22 |
| 7 (C) | 158.14 |
| 8 (CH) | 96.78 |
| 9 (C) | 154.24 |
| 10 (C) | 104.06 |
| 1' (C) | 132.3 |
| 2' (CH) | 115.72 |
| 3' (C) | 146.79 |
| 4' (C) | 145.65 |
| 5' (CH) | 116.36 |
| 6' (CH) | 119.87 |
| 2'' (CH) | 84.49 |
| 3'' (CH) | 68.12 |
| 4'' (CH2) | 28.96 |
| 5'' (C) | 156.15 |
| 6'' (CH) | 96.58 |
| 7'' (C) | 152.19 |
| 8'' (C) | 106.8 |
| 9'' (C) | 151.42 |
| 10'' (C) | 103.16 |
| 1''' (C) | 130.58 |
| 2''' (CH) | 115.77 |
| 3''' (C) | 146.79 |
| 4''' (C) | 146.34 |
| 5''' (CH) | 115.72 |
| 6''' (CH) | 120.73 |