Common Name: Apigenin 7-O-b-D-apiofuranosyl (1-->6)-b-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H28O14/c27-9-26(35)10-37-25(23(26)34)36-8-18-20(31)21(32)22(33)24(40-18)38-13-5-14(29)19-15(30)7-16(39-17(19)6-13)11-1-3-12(28)4-2-11/h1-7,18,20-25,27-29,31-35H,8-10H2/t18-,20-,21+,22-,23+,24-,25-,26-/m1/s1
InChIKey: InChIKey=OMWBSQBBFSNJKL-WJIQGHJMSA-N
Formula: C26H28O14
Molecular Weight: 564.493143
Exact Mass: 564.147906
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Wanjala, C.C.W., Majinda, R.R.T. Phytochemistry (1999) 51, 705-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.5 |
| 3 (CH) | 103.3 |
| 4 (C) | 182.2 |
| 5 (C) | 161.3 |
| 6 (CH) | 99.5 |
| 7 (C) | 163 |
| 8 (CH) | 94.9 |
| 9 (C) | 157.1 |
| 10 (C) | 105.5 |
| 1' (C) | 121.2 |
| 2' (CH) | 128.9 |
| 3' (CH) | 116.2 |
| 4' (C) | 161.6 |
| 5' (CH) | 116.2 |
| 6' (CH) | 128.9 |
| 1'' (CH) | 98.8 |
| 2'' (CH) | 73.5 |
| 3'' (CH) | 75.8 |
| 4'' (CH) | 68.6 |
| 5'' (CH) | 73.8 |
| 6'' (CH2) | 64.4 |
| 1''' (CH) | 109 |
| 2''' (CH) | 76.2 |
| 3''' (C) | 79.5 |
| 4''' (CH2) | 74.2 |
| 5''' (CH2) | 60.4 |